C24H30FN3O4S — CID 55959805
N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 55959805) has the molecular formula C24H30FN3O4S and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55959805 |
| Molecular Formula | C24H30FN3O4S |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NC1CCN(Cc2ccc(F)cc2)CC1)c1ccc(S(=O)(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C24H30FN3O4S/c25-20-7-3-18(4-8-20)17-28-13-11-21(12-14-28)27-24(29)19-5-9-23(10-6-19)33(30,31)26-16-22-2-1-15-32-22/h3-10,21-22,26H,1-2,11-17H2,(H,27,29) |
| InChIKey | AOAIJHAVGIOLBH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |