C24H27N3O4S — CID 55960356
N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-3-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 55960356) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-3-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55960356 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)c2cccc(S(=O)(=O)N3CCCCC3C)c2)c1 |
| InChI | InChI=1S/C24H27N3O4S/c1-4-19-10-7-12-21(15-19)25-23(28)17-26(3)24(29)20-11-8-13-22(16-20)32(30,31)27-14-6-5-9-18(27)2/h1,7-8,10-13,15-16,18H,5-6,9,14,17H2,2-3H3,(H,25,28) |
| InChIKey | PNJJFOXBSMVLJY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|