C19H25N3O5 — CID 55962022
methyl 2-[[3-[(2-acetamido-2-cyclopentylacetyl)amino]benzoyl]amino]acetate (PubChem CID 55962022) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is methyl 2-[[3-[(2-acetamido-2-cyclopentylacetyl)amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[3-[(2-acetamido-2-cyclopentylacetyl)amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55962022 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | methyl 2-[[3-[(2-acetamido-2-cyclopentylacetyl)amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cccc(NC(=O)C(NC(C)=O)C2CCCC2)c1 |
| InChI | InChI=1S/C19H25N3O5/c1-12(23)21-17(13-6-3-4-7-13)19(26)22-15-9-5-8-14(10-15)18(25)20-11-16(24)27-2/h5,8-10,13,17H,3-4,6-7,11H2,1-2H3,(H,20,25)(H,21,23)(H,22,26) |
| InChIKey | GXIRSRYLGUYYPS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |