C19H26N4O5 — CID 55779526
methyl 2-[[3-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]benzoyl]amino]acetate (PubChem CID 55779526) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is methyl 2-[[3-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[3-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55779526 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | methyl 2-[[3-[[1-(dimethylcarbamoyl)piperidine-4-carbonyl]amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cccc(NC(=O)C2CCN(C(=O)N(C)C)CC2)c1 |
| InChI | InChI=1S/C19H26N4O5/c1-22(2)19(27)23-9-7-13(8-10-23)18(26)21-15-6-4-5-14(11-15)17(25)20-12-16(24)28-3/h4-6,11,13H,7-10,12H2,1-3H3,(H,20,25)(H,21,26) |
| InChIKey | WQZIOPNUOJIQON-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |