C23H21ClN6O4 — CID 55963403
1-[(2-chlorophenyl)methyl]-N-[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]pyrazole-4-carboxamide (PubChem CID 55963403) has the molecular formula C23H21ClN6O4 and a molecular weight of 480.91 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55963403 |
| Molecular Formula | C23H21ClN6O4 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]pyrazole-4-carboxamide |
| SMILES | O=C(CCN1C(=O)CNC1=O)Nc1ccc(NC(=O)c2cnn(Cc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C23H21ClN6O4/c24-19-4-2-1-3-15(19)13-29-14-16(11-26-29)22(33)28-18-7-5-17(6-8-18)27-20(31)9-10-30-21(32)12-25-23(30)34/h1-8,11,14H,9-10,12-13H2,(H,25,34)(H,27,31)(H,28,33) |
| InChIKey | DRGFXZHCBPXYLX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|