C21H29BrN4O — CID 55964472
1-(4-bromophenyl)-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]pyrazole-4-carboxamide (PubChem CID 55964472) has the molecular formula C21H29BrN4O and a molecular weight of 433.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55964472 |
| Molecular Formula | C21H29BrN4O |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1-(4-bromophenyl)-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]pyrazole-4-carboxamide |
| SMILES | CC1CC(C)CN(CCCCNC(=O)c2cnn(-c3ccc(Br)cc3)c2)C1 |
| InChI | InChI=1S/C21H29BrN4O/c1-16-11-17(2)14-25(13-16)10-4-3-9-23-21(27)18-12-24-26(15-18)20-7-5-19(22)6-8-20/h5-8,12,15-17H,3-4,9-11,13-14H2,1-2H3,(H,23,27) |
| InChIKey | RDAFADLRJNUKLH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|