C21H20FN5O3 — CID 55965099
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]acetamide (PubChem CID 55965099) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]acetamide |
|---|---|
| PubChem CID | 55965099 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]acetamide |
| SMILES | CCN1CCN(CC(=O)Nc2ccc3nc(-c4ccc(F)cc4)[nH]c3c2)C(=O)C1=O |
| InChI | InChI=1S/C21H20FN5O3/c1-2-26-9-10-27(21(30)20(26)29)12-18(28)23-15-7-8-16-17(11-15)25-19(24-16)13-3-5-14(22)6-4-13/h3-8,11H,2,9-10,12H2,1H3,(H,23,28)(H,24,25) |
| InChIKey | CZCHPGYHVJRZFB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|