C22H22N4O3S — CID 60542012
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide (PubChem CID 60542012) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 60542012 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide |
| SMILES | CCN1CCN(CC(=O)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)C(=O)C1=O |
| InChI | InChI=1S/C22H22N4O3S/c1-3-25-10-11-26(22(29)21(25)28)13-19(27)23-16-7-5-15(6-8-16)20-24-17-9-4-14(2)12-18(17)30-20/h4-9,12H,3,10-11,13H2,1-2H3,(H,23,27) |
| InChIKey | ACTLYVPGTMGDJS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|