C22H21F2N3O4S — CID 55965688
2-[4-(difluoromethoxy)anilino]-N-[[3-(methylsulfamoyl)phenyl]methyl]benzamide (PubChem CID 55965688) has the molecular formula C22H21F2N3O4S and a molecular weight of 461.49 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)anilino]-N-[[3-(methylsulfamoyl)phenyl]methyl]benzamide.
| Compound Name | 2-[4-(difluoromethoxy)anilino]-N-[[3-(methylsulfamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55965688 |
| Molecular Formula | C22H21F2N3O4S |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-[4-(difluoromethoxy)anilino]-N-[[3-(methylsulfamoyl)phenyl]methyl]benzamide |
| SMILES | CNS(=O)(=O)c1cccc(CNC(=O)c2ccccc2Nc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C22H21F2N3O4S/c1-25-32(29,30)18-6-4-5-15(13-18)14-26-21(28)19-7-2-3-8-20(19)27-16-9-11-17(12-10-16)31-22(23)24/h2-13,22,25,27H,14H2,1H3,(H,26,28) |
| InChIKey | JLTGVQGXCCNALB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |