C20H17N3O4S2 — CID 55966924
2-cyclopropyl-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-1,1,3-trioxo-1,2-benzothiazole-6-carboxamide (PubChem CID 55966924) has the molecular formula C20H17N3O4S2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-cyclopropyl-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-1,1,3-trioxo-1,2-benzothiazole-6-carboxamide.
| Compound Name | 2-cyclopropyl-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-1,1,3-trioxo-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 55966924 |
| Molecular Formula | C20H17N3O4S2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 2-cyclopropyl-N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-1,1,3-trioxo-1,2-benzothiazole-6-carboxamide |
| SMILES | Cc1ccc(C)c2sc(NC(=O)c3ccc4c(c3)S(=O)(=O)N(C3CC3)C4=O)nc12 |
| InChI | InChI=1S/C20H17N3O4S2/c1-10-3-4-11(2)17-16(10)21-20(28-17)22-18(24)12-5-8-14-15(9-12)29(26,27)23(19(14)25)13-6-7-13/h3-5,8-9,13H,6-7H2,1-2H3,(H,21,22,24) |
| InChIKey | SCQVGDTXQDJCST-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |