C25H26N4O3 — CID 55967503
1-(3-methoxyphenyl)-2,5-dimethyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]pyrrole-3-carboxamide (PubChem CID 55967503) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2,5-dimethyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]pyrrole-3-carboxamide.
| Compound Name | 1-(3-methoxyphenyl)-2,5-dimethyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55967503 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-(3-methoxyphenyl)-2,5-dimethyl-N-[3-(2-pyrazol-1-ylethoxy)phenyl]pyrrole-3-carboxamide |
| SMILES | COc1cccc(-n2c(C)cc(C(=O)Nc3cccc(OCCn4cccn4)c3)c2C)c1 |
| InChI | InChI=1S/C25H26N4O3/c1-18-15-24(19(2)29(18)21-8-5-9-22(17-21)31-3)25(30)27-20-7-4-10-23(16-20)32-14-13-28-12-6-11-26-28/h4-12,15-17H,13-14H2,1-3H3,(H,27,30) |
| InChIKey | AMGZOCBBWDLJLC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|