C19H15BrN4O2S — CID 55970996
N-(2-acetamido-1,3-benzothiazol-6-yl)-3-bromo-1-methylindole-2-carboxamide (PubChem CID 55970996) has the molecular formula C19H15BrN4O2S and a molecular weight of 443.33 g/mol. Its IUPAC name is N-(2-acetamido-1,3-benzothiazol-6-yl)-3-bromo-1-methylindole-2-carboxamide.
| Compound Name | N-(2-acetamido-1,3-benzothiazol-6-yl)-3-bromo-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 55970996 |
| Molecular Formula | C19H15BrN4O2S |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | N-(2-acetamido-1,3-benzothiazol-6-yl)-3-bromo-1-methylindole-2-carboxamide |
| SMILES | CC(=O)Nc1nc2ccc(NC(=O)c3c(Br)c4ccccc4n3C)cc2s1 |
| InChI | InChI=1S/C19H15BrN4O2S/c1-10(25)21-19-23-13-8-7-11(9-15(13)27-19)22-18(26)17-16(20)12-5-3-4-6-14(12)24(17)2/h3-9H,1-2H3,(H,22,26)(H,21,23,25) |
| InChIKey | DKLAYCIRNGKABX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |