C14H12N6O4S — CID 5068246
N-(2-acetamido-1,3-benzothiazol-6-yl)-1-methyl-4-nitropyrazole-3-carboxamide (PubChem CID 5068246) has the molecular formula C14H12N6O4S and a molecular weight of 360.36 g/mol. Its IUPAC name is N-(2-acetamido-1,3-benzothiazol-6-yl)-1-methyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-(2-acetamido-1,3-benzothiazol-6-yl)-1-methyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5068246 |
| Molecular Formula | C14H12N6O4S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-(2-acetamido-1,3-benzothiazol-6-yl)-1-methyl-4-nitropyrazole-3-carboxamide |
| SMILES | CC(=O)Nc1nc2ccc(NC(=O)c3nn(C)cc3[N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C14H12N6O4S/c1-7(21)15-14-17-9-4-3-8(5-11(9)25-14)16-13(22)12-10(20(23)24)6-19(2)18-12/h3-6H,1-2H3,(H,16,22)(H,15,17,21) |
| InChIKey | AWQINOFBWBWOOC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|