C20H26F3N3O3 — CID 55976217
N-[3-oxo-3-(propylamino)propyl]-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide (PubChem CID 55976217) has the molecular formula C20H26F3N3O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is N-[3-oxo-3-(propylamino)propyl]-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide.
| Compound Name | N-[3-oxo-3-(propylamino)propyl]-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55976217 |
| Molecular Formula | C20H26F3N3O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[3-oxo-3-(propylamino)propyl]-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide |
| SMILES | CCCNC(=O)CCNC(=O)C1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H26F3N3O3/c1-2-10-24-17(27)7-11-25-18(28)14-8-12-26(13-9-14)19(29)15-3-5-16(6-4-15)20(21,22)23/h3-6,14H,2,7-13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | XFQZOXANFPGATE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |