C22H22F6N4O2 — CID 55934156
1-[4-(trifluoromethyl)benzoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperidine-4-carboxamide (PubChem CID 55934156) has the molecular formula C22H22F6N4O2 and a molecular weight of 488.43 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)benzoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(trifluoromethyl)benzoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55934156 |
| Molecular Formula | C22H22F6N4O2 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 1-[4-(trifluoromethyl)benzoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCNc1ncccc1C(F)(F)F)C1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H22F6N4O2/c23-21(24,25)16-5-3-15(4-6-16)20(34)32-12-7-14(8-13-32)19(33)31-11-10-30-18-17(22(26,27)28)2-1-9-29-18/h1-6,9,14H,7-8,10-13H2,(H,29,30)(H,31,33) |
| InChIKey | NYHYIXLWTLQGBV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|