C17H23F3N4O2 — CID 47891608
1-propanoyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperidine-2-carboxamide (PubChem CID 47891608) has the molecular formula C17H23F3N4O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 1-propanoyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperidine-2-carboxamide.
| Compound Name | 1-propanoyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 47891608 |
| Molecular Formula | C17H23F3N4O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-propanoyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]piperidine-2-carboxamide |
| SMILES | CCC(=O)N1CCCCC1C(=O)NCCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C17H23F3N4O2/c1-2-14(25)24-11-4-3-7-13(24)16(26)23-10-9-22-15-12(17(18,19)20)6-5-8-21-15/h5-6,8,13H,2-4,7,9-11H2,1H3,(H,21,22)(H,23,26) |
| InChIKey | GNELVKGQFATSQK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|