C24H25N5O — CID 55976787
N-(4-imidazol-1-ylbutyl)-1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide (PubChem CID 55976787) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is N-(4-imidazol-1-ylbutyl)-1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide.
| Compound Name | N-(4-imidazol-1-ylbutyl)-1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55976787 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-(4-imidazol-1-ylbutyl)-1-(4-methylphenyl)-3-phenylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(-n2cc(C(=O)NCCCCn3ccnc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H25N5O/c1-19-9-11-21(12-10-19)29-17-22(23(27-29)20-7-3-2-4-8-20)24(30)26-13-5-6-15-28-16-14-25-18-28/h2-4,7-12,14,16-18H,5-6,13,15H2,1H3,(H,26,30) |
| InChIKey | HOXFGLNXNIPWTD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|