C17H17BrN4O3 — CID 55977281
N-[4-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylamino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 55977281) has the molecular formula C17H17BrN4O3 and a molecular weight of 405.25 g/mol. Its IUPAC name is N-[4-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylamino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylamino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55977281 |
| Molecular Formula | C17H17BrN4O3 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-[4-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylamino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccco1)NCc1cn2cc(Br)ccc2n1 |
| InChI | InChI=1S/C17H17BrN4O3/c18-12-5-6-15-21-13(11-22(15)10-12)9-20-16(23)4-1-7-19-17(24)14-3-2-8-25-14/h2-3,5-6,8,10-11H,1,4,7,9H2,(H,19,24)(H,20,23) |
| InChIKey | IZRDZGODFJCSIU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|