C21H20N6O2S2 — CID 55977837
2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide (PubChem CID 55977837) has the molecular formula C21H20N6O2S2 and a molecular weight of 452.57 g/mol. Its IUPAC name is 2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55977837 |
| Molecular Formula | C21H20N6O2S2 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide |
| SMILES | O=C(CSCc1nc2sc3c(c2c(=O)[nH]1)CCC3)Nc1ccccc1Cn1cncn1 |
| InChI | InChI=1S/C21H20N6O2S2/c28-18(24-15-6-2-1-4-13(15)8-27-12-22-11-23-27)10-30-9-17-25-20(29)19-14-5-3-7-16(14)31-21(19)26-17/h1-2,4,6,11-12H,3,5,7-10H2,(H,24,28)(H,25,26,29) |
| InChIKey | BQJWLDBYASBNCH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |