C20H14F2N2O4 — CID 55978568
1-(2,4-difluorophenyl)-5-oxo-N-(2-oxochromen-6-yl)pyrrolidine-3-carboxamide (PubChem CID 55978568) has the molecular formula C20H14F2N2O4 and a molecular weight of 384.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-5-oxo-N-(2-oxochromen-6-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-5-oxo-N-(2-oxochromen-6-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55978568 |
| Molecular Formula | C20H14F2N2O4 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-(2,4-difluorophenyl)-5-oxo-N-(2-oxochromen-6-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc2oc(=O)ccc2c1)C1CC(=O)N(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C20H14F2N2O4/c21-13-2-4-16(15(22)9-13)24-10-12(8-18(24)25)20(27)23-14-3-5-17-11(7-14)1-6-19(26)28-17/h1-7,9,12H,8,10H2,(H,23,27) |
| InChIKey | SGWABBQLTKTWJE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|