C20H15F2N3O4 — CID 46404012
1-(2,4-difluorophenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 46404012) has the molecular formula C20H15F2N3O4 and a molecular weight of 399.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46404012 |
| Molecular Formula | C20H15F2N3O4 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)C3CC(=O)N(c4ccc(F)cc4F)C3)cc2C1=O |
| InChI | InChI=1S/C20H15F2N3O4/c1-24-19(28)13-4-3-12(8-14(13)20(24)29)23-18(27)10-6-17(26)25(9-10)16-5-2-11(21)7-15(16)22/h2-5,7-8,10H,6,9H2,1H3,(H,23,27) |
| InChIKey | HJIFSQVKVQWLPL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|