C20H17N3O4 — CID 1341038
(3S)-N-(2-methyl-1,3-dioxoisoindol-5-yl)-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 1341038) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is (3S)-N-(2-methyl-1,3-dioxoisoindol-5-yl)-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(2-methyl-1,3-dioxoisoindol-5-yl)-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 1341038 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (3S)-N-(2-methyl-1,3-dioxoisoindol-5-yl)-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)[C@H]3CC(=O)N(c4ccccc4)C3)cc2C1=O |
| InChI | InChI=1S/C20H17N3O4/c1-22-19(26)15-8-7-13(10-16(15)20(22)27)21-18(25)12-9-17(24)23(11-12)14-5-3-2-4-6-14/h2-8,10,12H,9,11H2,1H3,(H,21,25)/t12-/m0/s1 |
| InChIKey | BZBSXGRKMBEMRQ-LBPRGKRZSA-N |
| XLogP | 1.90 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|