C24H31N3O4 — CID 55979200
ethyl 1-ethyl-2,5-dimethyl-4-[3-(3-morpholin-4-ylanilino)-3-oxoprop-1-enyl]pyrrole-3-carboxylate (PubChem CID 55979200) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is ethyl 1-ethyl-2,5-dimethyl-4-[3-(3-morpholin-4-ylanilino)-3-oxoprop-1-enyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 1-ethyl-2,5-dimethyl-4-[3-(3-morpholin-4-ylanilino)-3-oxoprop-1-enyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55979200 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | ethyl 1-ethyl-2,5-dimethyl-4-[3-(3-morpholin-4-ylanilino)-3-oxoprop-1-enyl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C=CC(=O)Nc2cccc(N3CCOCC3)c2)c(C)n(CC)c1C |
| InChI | InChI=1S/C24H31N3O4/c1-5-27-17(3)21(23(18(27)4)24(29)31-6-2)10-11-22(28)25-19-8-7-9-20(16-19)26-12-14-30-15-13-26/h7-11,16H,5-6,12-15H2,1-4H3,(H,25,28) |
| InChIKey | RAWDPAWQEKZKAT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|