C23H29N3O4S — CID 56529481
ethyl 4-[(E)-3-[4-(dimethylcarbamoylsulfanyl)anilino]-3-oxoprop-1-enyl]-1-ethyl-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 56529481) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is ethyl 4-[(E)-3-[4-(dimethylcarbamoylsulfanyl)anilino]-3-oxoprop-1-enyl]-1-ethyl-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | ethyl 4-[(E)-3-[4-(dimethylcarbamoylsulfanyl)anilino]-3-oxoprop-1-enyl]-1-ethyl-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 56529481 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | ethyl 4-[(E)-3-[4-(dimethylcarbamoylsulfanyl)anilino]-3-oxoprop-1-enyl]-1-ethyl-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(/C=C/C(=O)Nc2ccc(SC(=O)N(C)C)cc2)c(C)n(CC)c1C |
| InChI | InChI=1S/C23H29N3O4S/c1-7-26-15(3)19(21(16(26)4)22(28)30-8-2)13-14-20(27)24-17-9-11-18(12-10-17)31-23(29)25(5)6/h9-14H,7-8H2,1-6H3,(H,24,27)/b14-13+ |
| InChIKey | WQLRLFXXYPUASM-BUHFOSPRSA-N |
| XLogP | 4.73 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|