C19H30N2O4 — CID 55981314
ethyl 1-[[1-(cyclopropanecarbonyl)piperidine-3-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 55981314) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is ethyl 1-[[1-(cyclopropanecarbonyl)piperidine-3-carbonyl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[[1-(cyclopropanecarbonyl)piperidine-3-carbonyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55981314 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | ethyl 1-[[1-(cyclopropanecarbonyl)piperidine-3-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)C2CCCN(C(=O)C3CC3)C2)CCCCC1 |
| InChI | InChI=1S/C19H30N2O4/c1-2-25-18(24)19(10-4-3-5-11-19)20-16(22)15-7-6-12-21(13-15)17(23)14-8-9-14/h14-15H,2-13H2,1H3,(H,20,22) |
| InChIKey | ZWMWDLUGPOKVLX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |