C18H32N2O5S — CID 55801599
ethyl 1-[(1-propylsulfonylpiperidine-3-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 55801599) has the molecular formula C18H32N2O5S and a molecular weight of 388.53 g/mol. Its IUPAC name is ethyl 1-[(1-propylsulfonylpiperidine-3-carbonyl)amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[(1-propylsulfonylpiperidine-3-carbonyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55801599 |
| Molecular Formula | C18H32N2O5S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | ethyl 1-[(1-propylsulfonylpiperidine-3-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | CCCS(=O)(=O)N1CCCC(C(=O)NC2(C(=O)OCC)CCCCC2)C1 |
| InChI | InChI=1S/C18H32N2O5S/c1-3-13-26(23,24)20-12-8-9-15(14-20)16(21)19-18(17(22)25-4-2)10-6-5-7-11-18/h15H,3-14H2,1-2H3,(H,19,21) |
| InChIKey | AFMHHENVGYOUEG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |