C20H26N4O3 — CID 55981320
1-(2-ethoxyphenyl)-N-(4-imidazol-1-ylbutyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55981320) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-N-(4-imidazol-1-ylbutyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-ethoxyphenyl)-N-(4-imidazol-1-ylbutyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55981320 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-(2-ethoxyphenyl)-N-(4-imidazol-1-ylbutyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1ccccc1N1CC(C(=O)NCCCCn2ccnc2)CC1=O |
| InChI | InChI=1S/C20H26N4O3/c1-2-27-18-8-4-3-7-17(18)24-14-16(13-19(24)25)20(26)22-9-5-6-11-23-12-10-21-15-23/h3-4,7-8,10,12,15-16H,2,5-6,9,11,13-14H2,1H3,(H,22,26) |
| InChIKey | KGGGXMFBFPKCJS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|