C26H32N2O4 — CID 55982263
N-[(4-methoxyphenyl)methyl]-1-(3-phenoxypropanoyl)-N-prop-2-enylpiperidine-3-carboxamide (PubChem CID 55982263) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-1-(3-phenoxypropanoyl)-N-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-1-(3-phenoxypropanoyl)-N-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55982263 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-1-(3-phenoxypropanoyl)-N-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCN(Cc1ccc(OC)cc1)C(=O)C1CCCN(C(=O)CCOc2ccccc2)C1 |
| InChI | InChI=1S/C26H32N2O4/c1-3-16-28(19-21-11-13-23(31-2)14-12-21)26(30)22-8-7-17-27(20-22)25(29)15-18-32-24-9-5-4-6-10-24/h3-6,9-14,22H,1,7-8,15-20H2,2H3 |
| InChIKey | VZSCRVXQQXEBOH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|