C26H31N3O4S — CID 55983352
3-(diethylsulfamoyl)-4-methoxy-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 55983352) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-4-methoxy-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 3-(diethylsulfamoyl)-4-methoxy-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55983352 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 3-(diethylsulfamoyl)-4-methoxy-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)ccc1OC |
| InChI | InChI=1S/C26H31N3O4S/c1-5-29(6-2)34(31,32)25-16-22(13-14-24(25)33-4)26(30)28(18-21-11-9-15-27-17-21)19-23-12-8-7-10-20(23)3/h7-17H,5-6,18-19H2,1-4H3 |
| InChIKey | ORFWMHVGXKFXAC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |