C24H25ClN2O3 — CID 47068322
3-chloro-4-ethoxy-5-methoxy-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 47068322) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 47068322 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N-[(2-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)cc1OC |
| InChI | InChI=1S/C24H25ClN2O3/c1-4-30-23-21(25)12-20(13-22(23)29-3)24(28)27(15-18-9-7-11-26-14-18)16-19-10-6-5-8-17(19)2/h5-14H,4,15-16H2,1-3H3 |
| InChIKey | WKLDTQJFSJKJHX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |