C21H24ClN3O3 — CID 60519812
3-chloro-N-(2-cyanoethyl)-5-methoxy-4-(2-methylpropoxy)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 60519812) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 3-chloro-N-(2-cyanoethyl)-5-methoxy-4-(2-methylpropoxy)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 3-chloro-N-(2-cyanoethyl)-5-methoxy-4-(2-methylpropoxy)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60519812 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 3-chloro-N-(2-cyanoethyl)-5-methoxy-4-(2-methylpropoxy)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | COc1cc(C(=O)N(CCC#N)Cc2cccnc2)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C21H24ClN3O3/c1-15(2)14-28-20-18(22)10-17(11-19(20)27-3)21(26)25(9-5-7-23)13-16-6-4-8-24-12-16/h4,6,8,10-12,15H,5,9,13-14H2,1-3H3 |
| InChIKey | XBKYOGWCMCHHMR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |