C20H18ClN3OS — CID 55984772
1-(3-chlorophenyl)-N-[4-(thiadiazol-4-yl)phenyl]cyclopentane-1-carboxamide (PubChem CID 55984772) has the molecular formula C20H18ClN3OS and a molecular weight of 383.90 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[4-(thiadiazol-4-yl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[4-(thiadiazol-4-yl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55984772 |
| Molecular Formula | C20H18ClN3OS |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[4-(thiadiazol-4-yl)phenyl]cyclopentane-1-carboxamide |
| SMILES | O=C(Nc1ccc(-c2csnn2)cc1)C1(c2cccc(Cl)c2)CCCC1 |
| InChI | InChI=1S/C20H18ClN3OS/c21-16-5-3-4-15(12-16)20(10-1-2-11-20)19(25)22-17-8-6-14(7-9-17)18-13-26-24-23-18/h3-9,12-13H,1-2,10-11H2,(H,22,25) |
| InChIKey | AAYNGRUCFOQDKX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |