C17H18ClN3O2 — CID 166355507
1-(3-chlorophenyl)-N-(6-oxo-1H-pyrazin-2-yl)cyclohexane-1-carboxamide (PubChem CID 166355507) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(6-oxo-1H-pyrazin-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-(6-oxo-1H-pyrazin-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166355507 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(6-oxo-1H-pyrazin-2-yl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cncc(=O)[nH]1)C1(c2cccc(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C17H18ClN3O2/c18-13-6-4-5-12(9-13)17(7-2-1-3-8-17)16(23)21-14-10-19-11-15(22)20-14/h4-6,9-11H,1-3,7-8H2,(H2,20,21,22,23) |
| InChIKey | MDGWSKZDKYLKSI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |