C20H23ClN2O — CID 78844552
1-(3-chlorophenyl)-N-(1-pyridin-4-ylethyl)cyclohexane-1-carboxamide (PubChem CID 78844552) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(1-pyridin-4-ylethyl)cyclohexane-1-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-(1-pyridin-4-ylethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 78844552 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(1-pyridin-4-ylethyl)cyclohexane-1-carboxamide |
| SMILES | CC(NC(=O)C1(c2cccc(Cl)c2)CCCCC1)c1ccncc1 |
| InChI | InChI=1S/C20H23ClN2O/c1-15(16-8-12-22-13-9-16)23-19(24)20(10-3-2-4-11-20)17-6-5-7-18(21)14-17/h5-9,12-15H,2-4,10-11H2,1H3,(H,23,24) |
| InChIKey | DZNDEQJMQBAYJQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |