C23H25N3O — CID 55984779
2,6-dimethyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]quinoline-3-carboxamide (PubChem CID 55984779) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 2,6-dimethyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]quinoline-3-carboxamide.
| Compound Name | 2,6-dimethyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 55984779 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2,6-dimethyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]quinoline-3-carboxamide |
| SMILES | Cc1ccc2nc(C)c(C(=O)NCc3ccccc3N3CCCC3)cc2c1 |
| InChI | InChI=1S/C23H25N3O/c1-16-9-10-21-19(13-16)14-20(17(2)25-21)23(27)24-15-18-7-3-4-8-22(18)26-11-5-6-12-26/h3-4,7-10,13-14H,5-6,11-12,15H2,1-2H3,(H,24,27) |
| InChIKey | UVUWCPGUNXJPEF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |