C20H24FN3O5S2 — CID 55984969
N-[2-(dimethylsulfamoyl)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 55984969) has the molecular formula C20H24FN3O5S2 and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-(dimethylsulfamoyl)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55984969 |
| Molecular Formula | C20H24FN3O5S2 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1NC(=O)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H24FN3O5S2/c1-23(2)31(28,29)19-8-4-3-7-18(19)22-20(25)15-6-5-13-24(14-15)30(26,27)17-11-9-16(21)10-12-17/h3-4,7-12,15H,5-6,13-14H2,1-2H3,(H,22,25) |
| InChIKey | YSYCMTJYFVREQL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |