C26H38N4O4 — CID 55986516
1-(2-butyl-1,3-dioxoisoindole-5-carbonyl)-N-[3-(dimethylamino)-2,2-dimethylpropyl]piperidine-4-carboxamide (PubChem CID 55986516) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 1-(2-butyl-1,3-dioxoisoindole-5-carbonyl)-N-[3-(dimethylamino)-2,2-dimethylpropyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-butyl-1,3-dioxoisoindole-5-carbonyl)-N-[3-(dimethylamino)-2,2-dimethylpropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55986516 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 1-(2-butyl-1,3-dioxoisoindole-5-carbonyl)-N-[3-(dimethylamino)-2,2-dimethylpropyl]piperidine-4-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N3CCC(C(=O)NCC(C)(C)CN(C)C)CC3)cc2C1=O |
| InChI | InChI=1S/C26H38N4O4/c1-6-7-12-30-24(33)20-9-8-19(15-21(20)25(30)34)23(32)29-13-10-18(11-14-29)22(31)27-16-26(2,3)17-28(4)5/h8-9,15,18H,6-7,10-14,16-17H2,1-5H3,(H,27,31) |
| InChIKey | VXHSVMBLAFUTNE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|