C21H33N3O4 — CID 55987097
N-(2,6-dimethylphenyl)-2-[4-[2-(2-ethoxyethoxy)propanoyl]piperazin-1-yl]acetamide (PubChem CID 55987097) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-[2-(2-ethoxyethoxy)propanoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-[2-(2-ethoxyethoxy)propanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55987097 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-[2-(2-ethoxyethoxy)propanoyl]piperazin-1-yl]acetamide |
| SMILES | CCOCCOC(C)C(=O)N1CCN(CC(=O)Nc2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C21H33N3O4/c1-5-27-13-14-28-18(4)21(26)24-11-9-23(10-12-24)15-19(25)22-20-16(2)7-6-8-17(20)3/h6-8,18H,5,9-15H2,1-4H3,(H,22,25) |
| InChIKey | FOOBTJVRAWATQV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|