C20H22ClNOS — CID 55989288
[4-[1-(4-chlorophenyl)ethylsulfanylmethyl]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 55989288) has the molecular formula C20H22ClNOS and a molecular weight of 359.92 g/mol. Its IUPAC name is [4-[1-(4-chlorophenyl)ethylsulfanylmethyl]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[1-(4-chlorophenyl)ethylsulfanylmethyl]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 55989288 |
| Molecular Formula | C20H22ClNOS |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [4-[1-(4-chlorophenyl)ethylsulfanylmethyl]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | CC(SCc1ccc(C(=O)N2CCCC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClNOS/c1-15(17-8-10-19(21)11-9-17)24-14-16-4-6-18(7-5-16)20(23)22-12-2-3-13-22/h4-11,15H,2-3,12-14H2,1H3 |
| InChIKey | YBOLQVOOUQONSO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |