C18H24N2O2S — CID 95155989
(2R)-N-prop-2-enyl-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylsulfanyl]propanamide (PubChem CID 95155989) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is (2R)-N-prop-2-enyl-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylsulfanyl]propanamide.
| Compound Name | (2R)-N-prop-2-enyl-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 95155989 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (2R)-N-prop-2-enyl-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylsulfanyl]propanamide |
| SMILES | C=CCNC(=O)[C@@H](C)SCc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O2S/c1-3-10-19-17(21)14(2)23-13-15-6-8-16(9-7-15)18(22)20-11-4-5-12-20/h3,6-9,14H,1,4-5,10-13H2,2H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | RZBVULISPIPNDX-CQSZACIVSA-N |
| XLogP | 2.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|