C18H23N3O3 — CID 92728970
(3S)-1-(4-acetamidobenzoyl)-N-prop-2-enylpiperidine-3-carboxamide (PubChem CID 92728970) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3S)-1-(4-acetamidobenzoyl)-N-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-acetamidobenzoyl)-N-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92728970 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (3S)-1-(4-acetamidobenzoyl)-N-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCNC(=O)[C@H]1CCCN(C(=O)c2ccc(NC(C)=O)cc2)C1 |
| InChI | InChI=1S/C18H23N3O3/c1-3-10-19-17(23)15-5-4-11-21(12-15)18(24)14-6-8-16(9-7-14)20-13(2)22/h3,6-9,15H,1,4-5,10-12H2,2H3,(H,19,23)(H,20,22)/t15-/m0/s1 |
| InChIKey | XPHGBTWGGRFEBY-HNNXBMFYSA-N |
| XLogP | 1.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|