C19H41N3O3S — CID 55989548
2-[[bis(3-methylbutyl)sulfamoylamino]methyl]-4-(2-methylpropyl)morpholine (PubChem CID 55989548) has the molecular formula C19H41N3O3S and a molecular weight of 391.62 g/mol. Its IUPAC name is 2-[[bis(3-methylbutyl)sulfamoylamino]methyl]-4-(2-methylpropyl)morpholine.
| Compound Name | 2-[[bis(3-methylbutyl)sulfamoylamino]methyl]-4-(2-methylpropyl)morpholine |
|---|---|
| PubChem CID | 55989548 |
| Molecular Formula | C19H41N3O3S |
| Molecular Weight | 391.62 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | 2-[[bis(3-methylbutyl)sulfamoylamino]methyl]-4-(2-methylpropyl)morpholine |
| SMILES | CC(C)CCN(CCC(C)C)S(=O)(=O)NCC1CN(CC(C)C)CCO1 |
| InChI | InChI=1S/C19H41N3O3S/c1-16(2)7-9-22(10-8-17(3)4)26(23,24)20-13-19-15-21(11-12-25-19)14-18(5)6/h16-20H,7-15H2,1-6H3 |
| InChIKey | NQGDECKNODIKIJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |