C15H26N4O4S — CID 55573428
1-methyl-4-[[4-(2-methylpropyl)morpholin-2-yl]methylsulfamoyl]pyrrole-2-carboxamide (PubChem CID 55573428) has the molecular formula C15H26N4O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is 1-methyl-4-[[4-(2-methylpropyl)morpholin-2-yl]methylsulfamoyl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-[[4-(2-methylpropyl)morpholin-2-yl]methylsulfamoyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55573428 |
| Molecular Formula | C15H26N4O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-methyl-4-[[4-(2-methylpropyl)morpholin-2-yl]methylsulfamoyl]pyrrole-2-carboxamide |
| SMILES | CC(C)CN1CCOC(CNS(=O)(=O)c2cc(C(N)=O)n(C)c2)C1 |
| InChI | InChI=1S/C15H26N4O4S/c1-11(2)8-19-4-5-23-12(9-19)7-17-24(21,22)13-6-14(15(16)20)18(3)10-13/h6,10-12,17H,4-5,7-9H2,1-3H3,(H2,16,20) |
| InChIKey | UDKVLLWBFCJMOY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |