C24H29ClN2O4S — CID 55990316
N-[4-(4-chloroanilino)-4-oxobutyl]-1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxamide (PubChem CID 55990316) has the molecular formula C24H29ClN2O4S and a molecular weight of 477.03 g/mol. Its IUPAC name is N-[4-(4-chloroanilino)-4-oxobutyl]-1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxamide.
| Compound Name | N-[4-(4-chloroanilino)-4-oxobutyl]-1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55990316 |
| Molecular Formula | C24H29ClN2O4S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-[4-(4-chloroanilino)-4-oxobutyl]-1-(2,5-dimethylphenyl)sulfonylcyclopentane-1-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)C2(C(=O)NCCCC(=O)Nc3ccc(Cl)cc3)CCCC2)c1 |
| InChI | InChI=1S/C24H29ClN2O4S/c1-17-7-8-18(2)21(16-17)32(30,31)24(13-3-4-14-24)23(29)26-15-5-6-22(28)27-20-11-9-19(25)10-12-20/h7-12,16H,3-6,13-15H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | CSDMTLWOPXSMQO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|