C23H27NO5S — CID 46665840
ethyl 4-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]benzoate (PubChem CID 46665840) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is ethyl 4-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 46665840 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | ethyl 4-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2(S(=O)(=O)c3cc(C)ccc3C)CCCC2)cc1 |
| InChI | InChI=1S/C23H27NO5S/c1-4-29-21(25)18-9-11-19(12-10-18)24-22(26)23(13-5-6-14-23)30(27,28)20-15-16(2)7-8-17(20)3/h7-12,15H,4-6,13-14H2,1-3H3,(H,24,26) |
| InChIKey | YEKWLWHEEMGDOU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |