About methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate
methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate (PubChem CID 24567718) has the molecular formula C20H23NO5S2
and a molecular weight of 421.54 g/mol. Its IUPAC name is methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate |
| PubChem CID | 24567718 |
| Molecular Formula | C20H23NO5S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)C2(S(=O)(=O)c3cc(C)ccc3C)CCCC2)s1 |
| InChI | InChI=1S/C20H23NO5S2/c1-13-6-7-14(2)16(12-13)28(24,25)20(10-4-5-11-20)19(23)21-17-9-8-15(27-17)18(22)26-3/h6-9,12H,4-5,10-11H2,1-3H3,(H,21,23) |
| InChIKey | QBCCBDHXWOHBNX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate?
The IUPAC name of methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate (CID 24567718) is methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate?
The canonical SMILES for methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate is COC(=O)c1ccc(NC(=O)C2(S(=O)(=O)c3cc(C)ccc3C)CCCC2)s1.
What is the InChIKey of methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate?
The InChIKey is QBCCBDHXWOHBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO5S2/c1-13-6-7-14(2)16(12-13)28(24,25)20(10-4-5-11-20)19(23)21-17-9-8-15(27-17)18(22)26-3/h6-9,12H,4-5,10-11H2,1-3H3,(H,21,23).
What are the key properties of methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate?
methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate has a molecular weight of 421.54 g/mol, XLogP of 3.88, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[1-(2,5-dimethylphenyl)sulfonylcyclopentanecarbonyl]amino]thiophene-2-carboxylate is sourced from PubChem (CID 24567718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).