C15H16ClN5O4 — CID 55991246
2-chloro-5-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-N-methylbenzamide (PubChem CID 55991246) has the molecular formula C15H16ClN5O4 and a molecular weight of 365.78 g/mol. Its IUPAC name is 2-chloro-5-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-N-methylbenzamide.
| Compound Name | 2-chloro-5-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 55991246 |
| Molecular Formula | C15H16ClN5O4 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-chloro-5-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(NC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)ccc1Cl |
| InChI | InChI=1S/C15H16ClN5O4/c1-8-14(21(24)25)9(2)20(19-8)7-13(22)18-10-4-5-12(16)11(6-10)15(23)17-3/h4-6H,7H2,1-3H3,(H,17,23)(H,18,22) |
| InChIKey | WGEJOFCXFHXZBU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|