C15H18ClN5O5S — CID 4130155
N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 4130155) has the molecular formula C15H18ClN5O5S and a molecular weight of 415.86 g/mol. Its IUPAC name is N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 4130155 |
| Molecular Formula | C15H18ClN5O5S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-[2-chloro-5-(dimethylsulfamoyl)phenyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2Cl)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18ClN5O5S/c1-9-15(21(23)24)10(2)20(18-9)8-14(22)17-13-7-11(5-6-12(13)16)27(25,26)19(3)4/h5-7H,8H2,1-4H3,(H,17,22) |
| InChIKey | YUBWYLKDYMKSSA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|