C25H20N4O5S — CID 55991388
2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-N-[2-(3-ethynylanilino)-2-oxoethyl]pyridine-3-carboxamide (PubChem CID 55991388) has the molecular formula C25H20N4O5S and a molecular weight of 488.53 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-N-[2-(3-ethynylanilino)-2-oxoethyl]pyridine-3-carboxamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-N-[2-(3-ethynylanilino)-2-oxoethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55991388 |
| Molecular Formula | C25H20N4O5S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanyl-N-[2-(3-ethynylanilino)-2-oxoethyl]pyridine-3-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)c2cccnc2SCC(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C25H20N4O5S/c1-2-16-5-3-6-17(11-16)28-22(30)13-27-24(32)19-7-4-10-26-25(19)35-14-23(31)29-18-8-9-20-21(12-18)34-15-33-20/h1,3-12H,13-15H2,(H,27,32)(H,28,30)(H,29,31) |
| InChIKey | FVAMITPIPJZXBM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|