C21H31N3O5S — CID 55993738
ethyl 1-[[3-(4-methylpiperazin-1-yl)sulfonylbenzoyl]amino]cyclohexane-1-carboxylate (PubChem CID 55993738) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is ethyl 1-[[3-(4-methylpiperazin-1-yl)sulfonylbenzoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[[3-(4-methylpiperazin-1-yl)sulfonylbenzoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55993738 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | ethyl 1-[[3-(4-methylpiperazin-1-yl)sulfonylbenzoyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)c2cccc(S(=O)(=O)N3CCN(C)CC3)c2)CCCCC1 |
| InChI | InChI=1S/C21H31N3O5S/c1-3-29-20(26)21(10-5-4-6-11-21)22-19(25)17-8-7-9-18(16-17)30(27,28)24-14-12-23(2)13-15-24/h7-9,16H,3-6,10-15H2,1-2H3,(H,22,25) |
| InChIKey | GXTPJKLUYPXFNB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |